C16H32N2O7Si2 — CID 175696779
methyl 2-[3-[[3-[(2-methoxy-2-oxoacetyl)amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoacetate (PubChem CID 175696779) has the molecular formula C16H32N2O7Si2 and a molecular weight of 420.61 g/mol. Its IUPAC name is methyl 2-[3-[[3-[(2-methoxy-2-oxoacetyl)amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoacetate.
| Compound Name | methyl 2-[3-[[3-[(2-methoxy-2-oxoacetyl)amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 175696779 |
| Molecular Formula | C16H32N2O7Si2 |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | methyl 2-[3-[[3-[(2-methoxy-2-oxoacetyl)amino]propyl-dimethylsilyl]oxy-dimethylsilyl]propylamino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCCC[Si](C)(C)O[Si](C)(C)CCCNC(=O)C(=O)OC |
| InChI | InChI=1S/C16H32N2O7Si2/c1-23-15(21)13(19)17-9-7-11-26(3,4)25-27(5,6)12-8-10-18-14(20)16(22)24-2/h7-12H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | GLWQPGADPJMVGO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|