C16H39NO6Si4 — CID 59172342
4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propylamino]-4-oxobutanoic acid (PubChem CID 59172342) has the molecular formula C16H39NO6Si4 and a molecular weight of 453.83 g/mol. Its IUPAC name is 4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propylamino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59172342 |
| Molecular Formula | C16H39NO6Si4 |
| Molecular Weight | 453.83 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-trimethylsilyloxysilyl]propylamino]-4-oxobutanoic acid |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCNC(=O)CCC(=O)O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H39NO6Si4/c1-24(2,3)21-26(7,8)23-27(9,22-25(4,5)6)14-10-13-17-15(18)11-12-16(19)20/h10-14H2,1-9H3,(H,17,18)(H,19,20) |
| InChIKey | JXFZZCBNCNJSLR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.83 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|