C20H51N2O4Si4+ — CID 167366189
dimethyl-[6-oxo-6-[3-tris(trimethylsilyloxy)silylpropylamino]hexyl]azanium (PubChem CID 167366189) has the molecular formula C20H51N2O4Si4+ and a molecular weight of 495.98 g/mol. Its IUPAC name is dimethyl-[6-oxo-6-[3-tris(trimethylsilyloxy)silylpropylamino]hexyl]azanium.
| Compound Name | dimethyl-[6-oxo-6-[3-tris(trimethylsilyloxy)silylpropylamino]hexyl]azanium |
|---|---|
| PubChem CID | 167366189 |
| Molecular Formula | C20H51N2O4Si4+ |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | dimethyl-[6-oxo-6-[3-tris(trimethylsilyloxy)silylpropylamino]hexyl]azanium |
| SMILES | C[NH+](C)CCCCCC(=O)NCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H50N2O4Si4/c1-22(2)18-14-12-13-16-20(23)21-17-15-19-30(24-27(3,4)5,25-28(6,7)8)26-29(9,10)11/h12-19H2,1-11H3,(H,21,23)/p+1 |
| InChIKey | ZNUWJYLGWYZBOE-UHFFFAOYSA-O |
| XLogP | 3.69 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|