C24H56N2O6Si4 — CID 174057343
ethyl 3-(dimethylamino)-8-oxo-8-[3-tris(trimethylsilyloxy)silylpropylamino]octanoate (PubChem CID 174057343) has the molecular formula C24H56N2O6Si4 and a molecular weight of 581.06 g/mol. Its IUPAC name is ethyl 3-(dimethylamino)-8-oxo-8-[3-tris(trimethylsilyloxy)silylpropylamino]octanoate.
| Compound Name | ethyl 3-(dimethylamino)-8-oxo-8-[3-tris(trimethylsilyloxy)silylpropylamino]octanoate |
|---|---|
| PubChem CID | 174057343 |
| Molecular Formula | C24H56N2O6Si4 |
| Molecular Weight | 581.06 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | ethyl 3-(dimethylamino)-8-oxo-8-[3-tris(trimethylsilyloxy)silylpropylamino]octanoate |
| SMILES | CCOC(=O)CC(CCCCC(=O)NCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)N(C)C |
| InChI | InChI=1S/C24H56N2O6Si4/c1-13-29-24(28)21-22(26(2)3)17-14-15-18-23(27)25-19-16-20-36(30-33(4,5)6,31-34(7,8)9)32-35(10,11)12/h22H,13-21H2,1-12H3,(H,25,27) |
| InChIKey | BCPCGDLYWWKSBU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.06 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|