C20H49ClN2O4Si4 — CID 167672800
[6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazanium;molecular hydrogen;chloride (PubChem CID 167672800) has the molecular formula C20H49ClN2O4Si4 and a molecular weight of 529.42 g/mol. Its IUPAC name is [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazanium;molecular hydrogen;chloride.
| Compound Name | [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazanium;molecular hydrogen;chloride |
|---|---|
| PubChem CID | 167672800 |
| Molecular Formula | C20H49ClN2O4Si4 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazanium;molecular hydrogen;chloride |
| SMILES | CC[Si](=O)C[Si](CCCNC(=O)CCCCC[NH+](C)C)(C[Si](=O)CC)O[Si](C)(C)C.[Cl-].[H][H] |
| InChI | InChI=1S/C20H46N2O4Si4.ClH.H2/c1-8-27(24)18-30(19-28(25)9-2,26-29(5,6)7)17-13-15-21-20(23)14-11-10-12-16-22(3)4;;/h8-19H2,1-7H3,(H,21,23);2*1H |
| InChIKey | FQLCOICZERJIJW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 76.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|