C24H55N2O7SSi4+ — CID 156682479
[6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-(4-sulfobutyl)azanium (PubChem CID 156682479) has the molecular formula C24H55N2O7SSi4+ and a molecular weight of 628.12 g/mol. Its IUPAC name is [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-(4-sulfobutyl)azanium.
| Compound Name | [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 156682479 |
| Molecular Formula | C24H55N2O7SSi4+ |
| Molecular Weight | 628.12 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-(4-sulfobutyl)azanium |
| SMILES | CC[Si](=O)C[Si](CCCNC(=O)CCCCC[N+](C)(C)CCCCS(=O)(=O)O)(C[Si](=O)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C24H54N2O7SSi4/c1-8-35(31)22-38(23-36(32)9-2,33-37(5,6)7)21-15-17-25-24(27)16-11-10-12-18-26(3,4)19-13-14-20-34(28,29)30/h8-23H2,1-7H3,(H-,25,27,28,29,30)/p+1 |
| InChIKey | SJXGIYDADCSEJY-UHFFFAOYSA-O |
| XLogP | 4.56 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.12 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|