C23H49N2O4Si4+ — CID 169031165
[6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-prop-2-ynylazanium (PubChem CID 169031165) has the molecular formula C23H49N2O4Si4+ and a molecular weight of 530.00 g/mol. Its IUPAC name is [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-prop-2-ynylazanium.
| Compound Name | [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-prop-2-ynylazanium |
|---|---|
| PubChem CID | 169031165 |
| Molecular Formula | C23H49N2O4Si4+ |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | [6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethyl-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CCCCCC(=O)NCCC[Si](C[Si](=O)CC)(C[Si](=O)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C23H48N2O4Si4/c1-9-18-25(4,5)19-14-12-13-16-23(26)24-17-15-20-33(21-30(27)10-2,22-31(28)11-3)29-32(6,7)8/h1H,10-22H2,2-8H3/p+1 |
| InChIKey | IBIOECBDJCRVSV-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|