C25H56N2O7SSi4 — CID 166047651
5-[[6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazaniumyl]pentane-1-sulfonate (PubChem CID 166047651) has the molecular formula C25H56N2O7SSi4 and a molecular weight of 641.14 g/mol. Its IUPAC name is 5-[[6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazaniumyl]pentane-1-sulfonate.
| Compound Name | 5-[[6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazaniumyl]pentane-1-sulfonate |
|---|---|
| PubChem CID | 166047651 |
| Molecular Formula | C25H56N2O7SSi4 |
| Molecular Weight | 641.14 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 5-[[6-[3-[bis[[ethyl(oxo)silyl]methyl]-trimethylsilyloxysilyl]propylamino]-6-oxohexyl]-dimethylazaniumyl]pentane-1-sulfonate |
| SMILES | CC[Si](=O)C[Si](CCCNC(=O)CCCCC[N+](C)(C)CCCCCS(=O)(=O)[O-])(C[Si](=O)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C25H56N2O7SSi4/c1-8-36(32)23-39(24-37(33)9-2,34-38(5,6)7)22-16-18-26-25(28)17-12-10-13-19-27(3,4)20-14-11-15-21-35(29,30)31/h8-24H2,1-7H3,(H-,26,28,29,30,31) |
| InChIKey | QUJZLUIUTVKYQR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.14 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|