C19H47O6Si5- — CID 20588934
5-[[butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-methyl-trimethylsilyloxysilyl]pentanoate (PubChem CID 20588934) has the molecular formula C19H47O6Si5- and a molecular weight of 512.01 g/mol. Its IUPAC name is 5-[[butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-methyl-trimethylsilyloxysilyl]pentanoate.
| Compound Name | 5-[[butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-methyl-trimethylsilyloxysilyl]pentanoate |
|---|---|
| PubChem CID | 20588934 |
| Molecular Formula | C19H47O6Si5- |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 5-[[butyl-[dimethyl(trimethylsilyloxy)silyl]oxy-methylsilyl]oxy-methyl-trimethylsilyloxysilyl]pentanoate |
| SMILES | CCCC[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(CCCCC(=O)[O-])O[Si](C)(C)C |
| InChI | InChI=1S/C19H48O6Si5/c1-12-13-17-30(11,24-28(8,9)22-26(2,3)4)25-29(10,23-27(5,6)7)18-15-14-16-19(20)21/h12-18H2,1-11H3,(H,20,21)/p-1 |
| InChIKey | UPJFKOSSYONNRL-UHFFFAOYSA-M |
| XLogP | 5.29 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|