C13H19FmN2O8- — CID 168904052
fermium;4-oxo-4-[2-[4-oxo-4-[2-(oxomethylamino)ethylamino]butanoyl]oxyethoxy]butanoic acid (PubChem CID 168904052) has the molecular formula C13H19FmN2O8- and a molecular weight of 588.30 g/mol. Its IUPAC name is fermium;4-oxo-4-[2-[4-oxo-4-[2-(oxomethylamino)ethylamino]butanoyl]oxyethoxy]butanoic acid.
| Compound Name | fermium;4-oxo-4-[2-[4-oxo-4-[2-(oxomethylamino)ethylamino]butanoyl]oxyethoxy]butanoic acid |
|---|---|
| PubChem CID | 168904052 |
| Molecular Formula | C13H19FmN2O8- |
| Molecular Weight | 588.30 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | fermium;4-oxo-4-[2-[4-oxo-4-[2-(oxomethylamino)ethylamino]butanoyl]oxyethoxy]butanoic acid |
| SMILES | O=[C-]NCCNC(=O)CCC(=O)OCCOC(=O)CCC(=O)O.[Fm] |
| InChI | InChI=1S/C13H19N2O8.Fm/c16-9-14-5-6-15-10(17)1-3-12(20)22-7-8-23-13(21)4-2-11(18)19;/h1-8H2,(H,14,16)(H,15,17)(H,18,19);/q-1; |
| InChIKey | OEPHNDWCAWHKOG-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.30 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|