C29H38N2O6 — CID 4935321
3-phenylpropyl 4-oxo-4-[3-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]propylamino]butanoate (PubChem CID 4935321) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is 3-phenylpropyl 4-oxo-4-[3-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]propylamino]butanoate.
| Compound Name | 3-phenylpropyl 4-oxo-4-[3-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]propylamino]butanoate |
|---|---|
| PubChem CID | 4935321 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 3-phenylpropyl 4-oxo-4-[3-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]propylamino]butanoate |
| SMILES | O=C(CCC(=O)OCCCc1ccccc1)NCCCNC(=O)CCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C29H38N2O6/c32-26(16-18-28(34)36-22-7-14-24-10-3-1-4-11-24)30-20-9-21-31-27(33)17-19-29(35)37-23-8-15-25-12-5-2-6-13-25/h1-6,10-13H,7-9,14-23H2,(H,30,32)(H,31,33) |
| InChIKey | OHPIYHXWPWYODB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|