C31H42N2O6 — CID 4924255
3-phenylpropyl 5-oxo-5-[2-[[5-oxo-5-(3-phenylpropoxy)pentanoyl]amino]propylamino]pentanoate (PubChem CID 4924255) has the molecular formula C31H42N2O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[2-[[5-oxo-5-(3-phenylpropoxy)pentanoyl]amino]propylamino]pentanoate.
| Compound Name | 3-phenylpropyl 5-oxo-5-[2-[[5-oxo-5-(3-phenylpropoxy)pentanoyl]amino]propylamino]pentanoate |
|---|---|
| PubChem CID | 4924255 |
| Molecular Formula | C31H42N2O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[2-[[5-oxo-5-(3-phenylpropoxy)pentanoyl]amino]propylamino]pentanoate |
| SMILES | CC(CNC(=O)CCCC(=O)OCCCc1ccccc1)NC(=O)CCCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C31H42N2O6/c1-25(33-29(35)19-9-21-31(37)39-23-11-17-27-14-6-3-7-15-27)24-32-28(34)18-8-20-30(36)38-22-10-16-26-12-4-2-5-13-26/h2-7,12-15,25H,8-11,16-24H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | DLCAVQJLOZNHQD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|