C27H34N2O6 — CID 146190363
2-[2-(4-phenylbutanoylamino)acetyl]oxyethyl 2-(4-phenylbutanoylamino)propanoate (PubChem CID 146190363) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-[2-(4-phenylbutanoylamino)acetyl]oxyethyl 2-(4-phenylbutanoylamino)propanoate.
| Compound Name | 2-[2-(4-phenylbutanoylamino)acetyl]oxyethyl 2-(4-phenylbutanoylamino)propanoate |
|---|---|
| PubChem CID | 146190363 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-[2-(4-phenylbutanoylamino)acetyl]oxyethyl 2-(4-phenylbutanoylamino)propanoate |
| SMILES | CC(NC(=O)CCCc1ccccc1)C(=O)OCCOC(=O)CNC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C27H34N2O6/c1-21(29-25(31)17-9-15-23-12-6-3-7-13-23)27(33)35-19-18-34-26(32)20-28-24(30)16-8-14-22-10-4-2-5-11-22/h2-7,10-13,21H,8-9,14-20H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | HYYPUPACNYDYCA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|