C15H18INO5 — CID 177221402
2-[(2S)-2-[4-(4-iodophenyl)butanoylamino]propanoyl]oxyacetic acid (PubChem CID 177221402) has the molecular formula C15H18INO5 and a molecular weight of 419.22 g/mol. Its IUPAC name is 2-[(2S)-2-[4-(4-iodophenyl)butanoylamino]propanoyl]oxyacetic acid.
| Compound Name | 2-[(2S)-2-[4-(4-iodophenyl)butanoylamino]propanoyl]oxyacetic acid |
|---|---|
| PubChem CID | 177221402 |
| Molecular Formula | C15H18INO5 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 2-[(2S)-2-[4-(4-iodophenyl)butanoylamino]propanoyl]oxyacetic acid |
| SMILES | C[C@H](NC(=O)CCCc1ccc(I)cc1)C(=O)OCC(=O)O |
| InChI | InChI=1S/C15H18INO5/c1-10(15(21)22-9-14(19)20)17-13(18)4-2-3-11-5-7-12(16)8-6-11/h5-8,10H,2-4,9H2,1H3,(H,17,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | WHMMZRBQHZLTCT-JTQLQIEISA-N |
| XLogP | 1.75 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|