C17H23NO3 — CID 166283041
methyl 2-[4-(4-cyclopropylphenyl)butanoylamino]propanoate (PubChem CID 166283041) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl 2-[4-(4-cyclopropylphenyl)butanoylamino]propanoate.
| Compound Name | methyl 2-[4-(4-cyclopropylphenyl)butanoylamino]propanoate |
|---|---|
| PubChem CID | 166283041 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl 2-[4-(4-cyclopropylphenyl)butanoylamino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CCCc1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C17H23NO3/c1-12(17(20)21-2)18-16(19)5-3-4-13-6-8-14(9-7-13)15-10-11-15/h6-9,12,15H,3-5,10-11H2,1-2H3,(H,18,19) |
| InChIKey | PPONEYNVBDEUCQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |