C37H50O3 — CID 70445056
1,7-bis[4-(4-propanoylcyclohexyl)phenyl]heptan-4-one (PubChem CID 70445056) has the molecular formula C37H50O3 and a molecular weight of 542.80 g/mol. Its IUPAC name is 1,7-bis[4-(4-propanoylcyclohexyl)phenyl]heptan-4-one.
| Compound Name | 1,7-bis[4-(4-propanoylcyclohexyl)phenyl]heptan-4-one |
|---|---|
| PubChem CID | 70445056 |
| Molecular Formula | C37H50O3 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 1,7-bis[4-(4-propanoylcyclohexyl)phenyl]heptan-4-one |
| SMILES | CCC(=O)C1CCC(c2ccc(CCCC(=O)CCCc3ccc(C4CCC(C(=O)CC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C37H50O3/c1-3-36(39)33-23-19-31(20-24-33)29-15-11-27(12-16-29)7-5-9-35(38)10-6-8-28-13-17-30(18-14-28)32-21-25-34(26-22-32)37(40)4-2/h11-18,31-34H,3-10,19-26H2,1-2H3 |
| InChIKey | QAZWMDKTIOXYMR-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |