C39H54O3 — CID 70444310
1,9-bis[4-(4-propanoylcyclohexyl)phenyl]nonan-5-one (PubChem CID 70444310) has the molecular formula C39H54O3 and a molecular weight of 570.86 g/mol. Its IUPAC name is 1,9-bis[4-(4-propanoylcyclohexyl)phenyl]nonan-5-one.
| Compound Name | 1,9-bis[4-(4-propanoylcyclohexyl)phenyl]nonan-5-one |
|---|---|
| PubChem CID | 70444310 |
| Molecular Formula | C39H54O3 |
| Molecular Weight | 570.86 g/mol |
| Exact Mass | 570.41 |
| IUPAC Name | 1,9-bis[4-(4-propanoylcyclohexyl)phenyl]nonan-5-one |
| SMILES | CCC(=O)C1CCC(c2ccc(CCCCC(=O)CCCCc3ccc(C4CCC(C(=O)CC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C39H54O3/c1-3-38(41)35-25-21-33(22-26-35)31-17-13-29(14-18-31)9-5-7-11-37(40)12-8-6-10-30-15-19-32(20-16-30)34-23-27-36(28-24-34)39(42)4-2/h13-20,33-36H,3-12,21-28H2,1-2H3 |
| InChIKey | YNMVWHRTAPKHIE-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.86 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|