C25H30O2 — CID 70445259
1-[4-[4-(4-propanoylcyclohexyl)phenyl]phenyl]butan-1-one (PubChem CID 70445259) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-[4-[4-(4-propanoylcyclohexyl)phenyl]phenyl]butan-1-one.
| Compound Name | 1-[4-[4-(4-propanoylcyclohexyl)phenyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 70445259 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-[4-[4-(4-propanoylcyclohexyl)phenyl]phenyl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(-c2ccc(C3CCC(C(=O)CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H30O2/c1-3-5-25(27)23-16-12-21(13-17-23)19-8-6-18(7-9-19)20-10-14-22(15-11-20)24(26)4-2/h6-9,12-13,16-17,20,22H,3-5,10-11,14-15H2,1-2H3 |
| InChIKey | QLAQTAOLFWPOQG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |