C8H14N4O4S — CID 155175161
3-[2-(2-azidoethylcarbamoyloxy)ethylsulfanyl]propanoic acid (PubChem CID 155175161) has the molecular formula C8H14N4O4S and a molecular weight of 262.29 g/mol. Its IUPAC name is 3-[2-(2-azidoethylcarbamoyloxy)ethylsulfanyl]propanoic acid.
| Compound Name | 3-[2-(2-azidoethylcarbamoyloxy)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 155175161 |
| Molecular Formula | C8H14N4O4S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-[2-(2-azidoethylcarbamoyloxy)ethylsulfanyl]propanoic acid |
| SMILES | [N-]=[N+]=NCCNC(=O)OCCSCCC(=O)O |
| InChI | InChI=1S/C8H14N4O4S/c9-12-11-3-2-10-8(15)16-4-6-17-5-1-7(13)14/h1-6H2,(H,10,15)(H,13,14) |
| InChIKey | OHIQBZBRVMOEPN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|