C11H18F3N5O6 — CID 131740374
(2S)-2-amino-6-(2-azidoethoxycarbonylamino)hexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 131740374) has the molecular formula C11H18F3N5O6 and a molecular weight of 373.29 g/mol. Its IUPAC name is (2S)-2-amino-6-(2-azidoethoxycarbonylamino)hexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-amino-6-(2-azidoethoxycarbonylamino)hexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 131740374 |
| Molecular Formula | C11H18F3N5O6 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2S)-2-amino-6-(2-azidoethoxycarbonylamino)hexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[N-]=[N+]=NCCOC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H17N5O4.C2HF3O2/c10-7(8(15)16)3-1-2-4-12-9(17)18-6-5-13-14-11;3-2(4,5)1(6)7/h7H,1-6,10H2,(H,12,17)(H,15,16);(H,6,7)/t7-;/m0./s1 |
| InChIKey | VUKQETVFOYYZFW-FJXQXJEOSA-N |
| XLogP | 1.24 |
| TPSA | 187.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|