C12H21N5O4 — CID 167653306
2-azidoethyl N-[(5S)-5-acetamido-6-oxoheptyl]carbamate (PubChem CID 167653306) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-azidoethyl N-[(5S)-5-acetamido-6-oxoheptyl]carbamate.
| Compound Name | 2-azidoethyl N-[(5S)-5-acetamido-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 167653306 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-azidoethyl N-[(5S)-5-acetamido-6-oxoheptyl]carbamate |
| SMILES | CC(=O)N[C@@H](CCCCNC(=O)OCCN=[N+]=[N-])C(C)=O |
| InChI | InChI=1S/C12H21N5O4/c1-9(18)11(16-10(2)19)5-3-4-6-14-12(20)21-8-7-15-17-13/h11H,3-8H2,1-2H3,(H,14,20)(H,16,19)/t11-/m0/s1 |
| InChIKey | QWUTZQPSDMHJIG-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 133.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|