C30H47N7O8 — CID 89223571
tert-butyl (2S)-2-[[(2S)-2-[[(2R)-2-(2-azidoethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 89223571) has the molecular formula C30H47N7O8 and a molecular weight of 633.75 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-[[(2R)-2-(2-azidoethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-[[(2R)-2-(2-azidoethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 89223571 |
| Molecular Formula | C30H47N7O8 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.35 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-[[(2R)-2-(2-azidoethoxycarbonylamino)propanoyl]amino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | C[C@@H](NC(=O)OCCN=[N+]=[N-])C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47N7O8/c1-20(34-28(42)43-18-17-33-37-31)24(38)36-23(19-21-13-9-8-10-14-21)25(39)35-22(26(40)44-29(2,3)4)15-11-12-16-32-27(41)45-30(5,6)7/h8-10,13-14,20,22-23H,11-12,15-19H2,1-7H3,(H,32,41)(H,34,42)(H,35,39)(H,36,38)/t20-,22+,23+/m1/s1 |
| InChIKey | YXADULRXTAIZSJ-PUHATCMVSA-N |
| XLogP | 3.66 |
| TPSA | 209.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|