About 4-sulfanylidenebutyl N-methylcarbamate
4-sulfanylidenebutyl N-methylcarbamate (PubChem CID 22381142) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is 4-sulfanylidenebutyl N-methylcarbamate.
Molecular Properties
| Compound Name | 4-sulfanylidenebutyl N-methylcarbamate |
| PubChem CID | 22381142 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 4-sulfanylidenebutyl N-methylcarbamate |
| SMILES | CNC(=O)OCCCC=S |
| InChI | InChI=1S/C6H11NO2S/c1-7-6(8)9-4-2-3-5-10/h5H,2-4H2,1H3,(H,7,8) |
| InChIKey | KPPMLZWXIIOVEC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylidenebutyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylidenebutyl N-methylcarbamate?
The IUPAC name of 4-sulfanylidenebutyl N-methylcarbamate (CID 22381142) is 4-sulfanylidenebutyl N-methylcarbamate.
What is the SMILES notation for 4-sulfanylidenebutyl N-methylcarbamate?
The canonical SMILES for 4-sulfanylidenebutyl N-methylcarbamate is CNC(=O)OCCCC=S.
What is the InChIKey of 4-sulfanylidenebutyl N-methylcarbamate?
The InChIKey is KPPMLZWXIIOVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-7-6(8)9-4-2-3-5-10/h5H,2-4H2,1H3,(H,7,8).
What are the key properties of 4-sulfanylidenebutyl N-methylcarbamate?
4-sulfanylidenebutyl N-methylcarbamate has a molecular weight of 161.23 g/mol, XLogP of 1.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylidenebutyl N-methylcarbamate is sourced from PubChem (CID 22381142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).