C13H24N4O6 — CID 20736983
2-[[5-[2-(methylcarbamoyloxy)ethylamino]-5-oxopentanoyl]amino]ethyl N-methylcarbamate (PubChem CID 20736983) has the molecular formula C13H24N4O6 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[[5-[2-(methylcarbamoyloxy)ethylamino]-5-oxopentanoyl]amino]ethyl N-methylcarbamate.
| Compound Name | 2-[[5-[2-(methylcarbamoyloxy)ethylamino]-5-oxopentanoyl]amino]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 20736983 |
| Molecular Formula | C13H24N4O6 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[[5-[2-(methylcarbamoyloxy)ethylamino]-5-oxopentanoyl]amino]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCNC(=O)CCCC(=O)NCCOC(=O)NC |
| InChI | InChI=1S/C13H24N4O6/c1-14-12(20)22-8-6-16-10(18)4-3-5-11(19)17-7-9-23-13(21)15-2/h3-9H2,1-2H3,(H,14,20)(H,15,21)(H,16,18)(H,17,19) |
| InChIKey | APKUOLWMKMSIQW-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|