C17H26N2O7S2 — CID 169042160
6-(2,5-dioxopyrrol-1-yl)hexyl 2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl carbonate (PubChem CID 169042160) has the molecular formula C17H26N2O7S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)hexyl 2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl carbonate.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)hexyl 2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl carbonate |
|---|---|
| PubChem CID | 169042160 |
| Molecular Formula | C17H26N2O7S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)hexyl 2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl carbonate |
| SMILES | CNC(=O)OCCSSCCOC(=O)OCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H26N2O7S2/c1-18-16(22)24-10-12-27-28-13-11-26-17(23)25-9-5-3-2-4-8-19-14(20)6-7-15(19)21/h6-7H,2-5,8-13H2,1H3,(H,18,22) |
| InChIKey | MQKXXBZJDDAYOC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|