C19H43NO7Si4 — CID 88661534
[1-carbamoyloxy-5-tris(trimethylsilyloxy)silylpentan-2-yl] 2-methylprop-2-enoate (PubChem CID 88661534) has the molecular formula C19H43NO7Si4 and a molecular weight of 509.90 g/mol. Its IUPAC name is [1-carbamoyloxy-5-tris(trimethylsilyloxy)silylpentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-carbamoyloxy-5-tris(trimethylsilyloxy)silylpentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88661534 |
| Molecular Formula | C19H43NO7Si4 |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [1-carbamoyloxy-5-tris(trimethylsilyloxy)silylpentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)COC(N)=O |
| InChI | InChI=1S/C19H43NO7Si4/c1-16(2)18(21)24-17(15-23-19(20)22)13-12-14-31(25-28(3,4)5,26-29(6,7)8)27-30(9,10)11/h17H,1,12-15H2,2-11H3,(H2,20,22) |
| InChIKey | ALSSRVXMSQLOEI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|