C19H52O8Si6 — CID 87433103
3-[1-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]propoxy]propane-1,2-diol (PubChem CID 87433103) has the molecular formula C19H52O8Si6 and a molecular weight of 577.13 g/mol. Its IUPAC name is 3-[1-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]propoxy]propane-1,2-diol.
| Compound Name | 3-[1-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]propoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 87433103 |
| Molecular Formula | C19H52O8Si6 |
| Molecular Weight | 577.13 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 3-[1-[[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silyl]propoxy]propane-1,2-diol |
| SMILES | CCC(OCC(O)CO)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H52O8Si6/c1-15-19(22-17-18(21)16-20)33(25-30(8,9)10,26-31(11,12)13)27-32(14,23-28(2,3)4)24-29(5,6)7/h18-21H,15-17H2,1-14H3 |
| InChIKey | HZVPELYPCNOMOU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.13 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|