C19H30F8O6Si2 — CID 19766558
1-O-[1-[1-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethyl] 4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) (E)-but-2-enedioate (PubChem CID 19766558) has the molecular formula C19H30F8O6Si2 and a molecular weight of 562.60 g/mol. Its IUPAC name is 1-O-[1-[1-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethyl] 4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) (E)-but-2-enedioate.
| Compound Name | 1-O-[1-[1-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethyl] 4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 19766558 |
| Molecular Formula | C19H30F8O6Si2 |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 1-O-[1-[1-[dimethyl(trimethylsilyloxy)silyl]propoxy]ethyl] 4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) (E)-but-2-enedioate |
| SMILES | CCC(OC(C)OC(=O)/C=C/C(=O)OC(F)(F)C(F)(F)C(F)(F)C(C)(F)F)[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H30F8O6Si2/c1-9-15(35(7,8)33-34(4,5)6)31-12(2)30-13(28)10-11-14(29)32-19(26,27)18(24,25)17(22,23)16(3,20)21/h10-12,15H,9H2,1-8H3/b11-10+ |
| InChIKey | OPFOOIBTNQHNQS-ZHACJKMWSA-N |
| XLogP | 5.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|