C19H34F8O7Si4 — CID 54530861
4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) 1-O-[tris(trimethylsilyloxy)silylmethyl] but-2-enedioate (PubChem CID 54530861) has the molecular formula C19H34F8O7Si4 and a molecular weight of 638.80 g/mol. Its IUPAC name is 4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) 1-O-[tris(trimethylsilyloxy)silylmethyl] but-2-enedioate.
| Compound Name | 4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) 1-O-[tris(trimethylsilyloxy)silylmethyl] but-2-enedioate |
|---|---|
| PubChem CID | 54530861 |
| Molecular Formula | C19H34F8O7Si4 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.13 |
| IUPAC Name | 4-O-(1,1,2,2,3,3,4,4-octafluoropentyl) 1-O-[tris(trimethylsilyloxy)silylmethyl] but-2-enedioate |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(=O)C=CC(=O)OC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H34F8O7Si4/c1-16(20,21)17(22,23)18(24,25)19(26,27)31-15(29)12-11-14(28)30-13-38(32-35(2,3)4,33-36(5,6)7)34-37(8,9)10/h11-12H,13H2,1-10H3 |
| InChIKey | YWKPGEOEQQXRJV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|