C19H36F6O7Si4 — CID 123525642
4-oxo-4-[1,1,1-trifluoro-5,5-dimethyl-3-[silyloxy-bis(trimethylsilyloxy)silyl]-2-(trifluoromethyl)hexan-3-yl]oxybut-2-enoic acid (PubChem CID 123525642) has the molecular formula C19H36F6O7Si4 and a molecular weight of 602.82 g/mol. Its IUPAC name is 4-oxo-4-[1,1,1-trifluoro-5,5-dimethyl-3-[silyloxy-bis(trimethylsilyloxy)silyl]-2-(trifluoromethyl)hexan-3-yl]oxybut-2-enoic acid.
| Compound Name | 4-oxo-4-[1,1,1-trifluoro-5,5-dimethyl-3-[silyloxy-bis(trimethylsilyloxy)silyl]-2-(trifluoromethyl)hexan-3-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 123525642 |
| Molecular Formula | C19H36F6O7Si4 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.14 |
| IUPAC Name | 4-oxo-4-[1,1,1-trifluoro-5,5-dimethyl-3-[silyloxy-bis(trimethylsilyloxy)silyl]-2-(trifluoromethyl)hexan-3-yl]oxybut-2-enoic acid |
| SMILES | CC(C)(C)CC(OC(=O)C=CC(=O)O)(C(C(F)(F)F)C(F)(F)F)[Si](O[SiH3])(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H36F6O7Si4/c1-16(2,3)12-17(29-14(28)11-10-13(26)27,15(18(20,21)22)19(23,24)25)36(30-33,31-34(4,5)6)32-35(7,8)9/h10-11,15H,12H2,1-9,33H3,(H,26,27) |
| InChIKey | GYAYIQONWIRXAZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|