C13H18F6O4Si — CID 54139346
4-oxo-4-[1,1,1-trifluoro-2-(trifluoromethyl)-5-trimethylsilylpentan-3-yl]oxybut-2-enoic acid (PubChem CID 54139346) has the molecular formula C13H18F6O4Si and a molecular weight of 380.36 g/mol. Its IUPAC name is 4-oxo-4-[1,1,1-trifluoro-2-(trifluoromethyl)-5-trimethylsilylpentan-3-yl]oxybut-2-enoic acid.
| Compound Name | 4-oxo-4-[1,1,1-trifluoro-2-(trifluoromethyl)-5-trimethylsilylpentan-3-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 54139346 |
| Molecular Formula | C13H18F6O4Si |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-oxo-4-[1,1,1-trifluoro-2-(trifluoromethyl)-5-trimethylsilylpentan-3-yl]oxybut-2-enoic acid |
| SMILES | C[Si](C)(C)CCC(OC(=O)C=CC(=O)O)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H18F6O4Si/c1-24(2,3)7-6-8(23-10(22)5-4-9(20)21)11(12(14,15)16)13(17,18)19/h4-5,8,11H,6-7H2,1-3H3,(H,20,21) |
| InChIKey | NZZLFUMVIIVWEB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|