C13H24O4Si — CID 54530427
4-(4-methyl-1-trimethylsilylpentan-3-yl)oxy-4-oxobut-2-enoic acid (PubChem CID 54530427) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is 4-(4-methyl-1-trimethylsilylpentan-3-yl)oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-(4-methyl-1-trimethylsilylpentan-3-yl)oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54530427 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-(4-methyl-1-trimethylsilylpentan-3-yl)oxy-4-oxobut-2-enoic acid |
| SMILES | CC(C)C(CC[Si](C)(C)C)OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C13H24O4Si/c1-10(2)11(8-9-18(3,4)5)17-13(16)7-6-12(14)15/h6-7,10-11H,8-9H2,1-5H3,(H,14,15) |
| InChIKey | YWDBMCZFJHGYBD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|