C15H23F6O5Si2- — CID 151396302
(E)-4-[3-[dimethyl(trimethylsilyloxy)silyl]-5,5,5-trifluoro-4-(trifluoromethyl)pentoxy]-4-oxobut-2-enoate (PubChem CID 151396302) has the molecular formula C15H23F6O5Si2- and a molecular weight of 453.50 g/mol. Its IUPAC name is (E)-4-[3-[dimethyl(trimethylsilyloxy)silyl]-5,5,5-trifluoro-4-(trifluoromethyl)pentoxy]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[3-[dimethyl(trimethylsilyloxy)silyl]-5,5,5-trifluoro-4-(trifluoromethyl)pentoxy]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 151396302 |
| Molecular Formula | C15H23F6O5Si2- |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (E)-4-[3-[dimethyl(trimethylsilyloxy)silyl]-5,5,5-trifluoro-4-(trifluoromethyl)pentoxy]-4-oxobut-2-enoate |
| SMILES | C[Si](C)(C)O[Si](C)(C)C(CCOC(=O)/C=C/C(=O)[O-])C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H24F6O5Si2/c1-27(2,3)26-28(4,5)10(13(14(16,17)18)15(19,20)21)8-9-25-12(24)7-6-11(22)23/h6-7,10,13H,8-9H2,1-5H3,(H,22,23)/p-1/b7-6+ |
| InChIKey | OVNJJLOLKUQQOK-VOTSOKGWSA-M |
| XLogP | 3.39 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|