C9H8F5O4- — CID 7108571
(E)-4-oxo-4-(4,4,5,5,5-pentafluoropentoxy)but-2-enoate (PubChem CID 7108571) has the molecular formula C9H8F5O4- and a molecular weight of 275.15 g/mol. Its IUPAC name is (E)-4-oxo-4-(4,4,5,5,5-pentafluoropentoxy)but-2-enoate.
| Compound Name | (E)-4-oxo-4-(4,4,5,5,5-pentafluoropentoxy)but-2-enoate |
|---|---|
| PubChem CID | 7108571 |
| Molecular Formula | C9H8F5O4- |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (E)-4-oxo-4-(4,4,5,5,5-pentafluoropentoxy)but-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)OCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F5O4/c10-8(11,9(12,13)14)4-1-5-18-7(17)3-2-6(15)16/h2-3H,1,4-5H2,(H,15,16)/p-1/b3-2+ |
| InChIKey | DMNXHLVQWNHIFS-NSCUHMNNSA-M |
| XLogP | 0.81 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|