C7H5F4O4- — CID 71381327
4-oxo-4-(2,2,3,3-tetrafluoropropoxy)but-2-enoate (PubChem CID 71381327) has the molecular formula C7H5F4O4- and a molecular weight of 229.10 g/mol. Its IUPAC name is 4-oxo-4-(2,2,3,3-tetrafluoropropoxy)but-2-enoate.
| Compound Name | 4-oxo-4-(2,2,3,3-tetrafluoropropoxy)but-2-enoate |
|---|---|
| PubChem CID | 71381327 |
| Molecular Formula | C7H5F4O4- |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 4-oxo-4-(2,2,3,3-tetrafluoropropoxy)but-2-enoate |
| SMILES | O=C([O-])C=CC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H6F4O4/c8-6(9)7(10,11)3-15-5(14)2-1-4(12)13/h1-2,6H,3H2,(H,12,13)/p-1 |
| InChIKey | LLXKSMGCIPGLKO-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|