C13H10ClF4NO3 — CID 2837409
2,2,3,3-tetrafluoropropyl 4-(4-chloroanilino)-4-oxobut-2-enoate (PubChem CID 2837409) has the molecular formula C13H10ClF4NO3 and a molecular weight of 339.67 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-(4-chloroanilino)-4-oxobut-2-enoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-(4-chloroanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 2837409 |
| Molecular Formula | C13H10ClF4NO3 |
| Molecular Weight | 339.67 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-(4-chloroanilino)-4-oxobut-2-enoate |
| SMILES | O=C(C=CC(=O)OCC(F)(F)C(F)F)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClF4NO3/c14-8-1-3-9(4-2-8)19-10(20)5-6-11(21)22-7-13(17,18)12(15)16/h1-6,12H,7H2,(H,19,20) |
| InChIKey | BBDXDLIFFPWZPS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.67 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|