C11H10ClF4NO3 — CID 795112
2,2,3,3-tetrafluoropropyl N-(3-chloro-4-methoxyphenyl)carbamate (PubChem CID 795112) has the molecular formula C11H10ClF4NO3 and a molecular weight of 315.65 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl N-(3-chloro-4-methoxyphenyl)carbamate.
| Compound Name | 2,2,3,3-tetrafluoropropyl N-(3-chloro-4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 795112 |
| Molecular Formula | C11H10ClF4NO3 |
| Molecular Weight | 315.65 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl N-(3-chloro-4-methoxyphenyl)carbamate |
| SMILES | COc1ccc(NC(=O)OCC(F)(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C11H10ClF4NO3/c1-19-8-3-2-6(4-7(8)12)17-10(18)20-5-11(15,16)9(13)14/h2-4,9H,5H2,1H3,(H,17,18) |
| InChIKey | WLVXKHLUGUXRLY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|