C17H12F4O4 — CID 91718912
4-O-naphthalen-1-yl 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate (PubChem CID 91718912) has the molecular formula C17H12F4O4 and a molecular weight of 356.27 g/mol. Its IUPAC name is 4-O-naphthalen-1-yl 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate.
| Compound Name | 4-O-naphthalen-1-yl 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91718912 |
| Molecular Formula | C17H12F4O4 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-O-naphthalen-1-yl 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)Oc1cccc2ccccc12)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C17H12F4O4/c18-16(19)17(20,21)10-24-14(22)8-9-15(23)25-13-7-3-5-11-4-1-2-6-12(11)13/h1-9,16H,10H2/b9-8+ |
| InChIKey | YRKKVIPTLMNIKU-CMDGGOBGSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|