About diphenanthridin-1-yl (Z)-but-2-enedioate
diphenanthridin-1-yl (Z)-but-2-enedioate (PubChem CID 175422022) has the molecular formula C30H18N2O4
and a molecular weight of 470.48 g/mol. Its IUPAC name is diphenanthridin-1-yl (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | diphenanthridin-1-yl (Z)-but-2-enedioate |
| PubChem CID | 175422022 |
| Molecular Formula | C30H18N2O4 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | diphenanthridin-1-yl (Z)-but-2-enedioate |
| SMILES | O=C(/C=C\C(=O)Oc1cccc2ncc3ccccc3c12)Oc1cccc2ncc3ccccc3c12 |
| InChI | InChI=1S/C30H18N2O4/c33-27(35-25-13-5-11-23-29(25)21-9-3-1-7-19(21)17-31-23)15-16-28(34)36-26-14-6-12-24-30(26)22-10-4-2-8-20(22)18-32-24/h1-18H/b16-15- |
| InChIKey | CVDFWZGGCXAJGG-NXVVXOECSA-N |
| XLogP | 6.16 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze diphenanthridin-1-yl (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenanthridin-1-yl (Z)-but-2-enedioate?
The IUPAC name of diphenanthridin-1-yl (Z)-but-2-enedioate (CID 175422022) is diphenanthridin-1-yl (Z)-but-2-enedioate.
What is the SMILES notation for diphenanthridin-1-yl (Z)-but-2-enedioate?
The canonical SMILES for diphenanthridin-1-yl (Z)-but-2-enedioate is O=C(/C=C\C(=O)Oc1cccc2ncc3ccccc3c12)Oc1cccc2ncc3ccccc3c12.
What is the InChIKey of diphenanthridin-1-yl (Z)-but-2-enedioate?
The InChIKey is CVDFWZGGCXAJGG-NXVVXOECSA-N. The full InChI is InChI=1S/C30H18N2O4/c33-27(35-25-13-5-11-23-29(25)21-9-3-1-7-19(21)17-31-23)15-16-28(34)36-26-14-6-12-24-30(26)22-10-4-2-8-20(22)18-32-24/h1-18H/b16-15-.
What are the key properties of diphenanthridin-1-yl (Z)-but-2-enedioate?
diphenanthridin-1-yl (Z)-but-2-enedioate has a molecular weight of 470.48 g/mol, XLogP of 6.16, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diphenanthridin-1-yl (Z)-but-2-enedioate is sourced from PubChem (CID 175422022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).