About 1-bromophenanthridine;hydrate
1-bromophenanthridine;hydrate (PubChem CID 175162345) has the molecular formula C13H10BrNO
and a molecular weight of 276.13 g/mol. Its IUPAC name is 1-bromophenanthridine;hydrate.
Molecular Properties
| Compound Name | 1-bromophenanthridine;hydrate |
| PubChem CID | 175162345 |
| Molecular Formula | C13H10BrNO |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 1-bromophenanthridine;hydrate |
| SMILES | Brc1cccc2ncc3ccccc3c12.O |
| InChI | InChI=1S/C13H8BrN.H2O/c14-11-6-3-7-12-13(11)10-5-2-1-4-9(10)8-15-12;/h1-8H;1H2 |
| InChIKey | KBSUHFBYEMAZTE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-bromophenanthridine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromophenanthridine;hydrate?
The IUPAC name of 1-bromophenanthridine;hydrate (CID 175162345) is 1-bromophenanthridine;hydrate.
What is the SMILES notation for 1-bromophenanthridine;hydrate?
The canonical SMILES for 1-bromophenanthridine;hydrate is Brc1cccc2ncc3ccccc3c12.O.
What is the InChIKey of 1-bromophenanthridine;hydrate?
The InChIKey is KBSUHFBYEMAZTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN.H2O/c14-11-6-3-7-12-13(11)10-5-2-1-4-9(10)8-15-12;/h1-8H;1H2.
What are the key properties of 1-bromophenanthridine;hydrate?
1-bromophenanthridine;hydrate has a molecular weight of 276.13 g/mol, XLogP of 3.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromophenanthridine;hydrate is sourced from PubChem (CID 175162345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).