C14H11ClF4O4 — CID 91734680
4-O-(4-chloro-2-methylphenyl) 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate (PubChem CID 91734680) has the molecular formula C14H11ClF4O4 and a molecular weight of 354.68 g/mol. Its IUPAC name is 4-O-(4-chloro-2-methylphenyl) 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate.
| Compound Name | 4-O-(4-chloro-2-methylphenyl) 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91734680 |
| Molecular Formula | C14H11ClF4O4 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 4-O-(4-chloro-2-methylphenyl) 1-O-(2,2,3,3-tetrafluoropropyl) (E)-but-2-enedioate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)/C=C/C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H11ClF4O4/c1-8-6-9(15)2-3-10(8)23-12(21)5-4-11(20)22-7-14(18,19)13(16)17/h2-6,13H,7H2,1H3/b5-4+ |
| InChIKey | JNECXXXNXBLUAD-SNAWJCMRSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|