C16H9ClF6O2 — CID 91737821
(4-chloro-2-methylphenyl) 2,5-bis(trifluoromethyl)benzoate (PubChem CID 91737821) has the molecular formula C16H9ClF6O2 and a molecular weight of 382.69 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 2,5-bis(trifluoromethyl)benzoate.
| Compound Name | (4-chloro-2-methylphenyl) 2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 91737821 |
| Molecular Formula | C16H9ClF6O2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (4-chloro-2-methylphenyl) 2,5-bis(trifluoromethyl)benzoate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)c1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H9ClF6O2/c1-8-6-10(17)3-5-13(8)25-14(24)11-7-9(15(18,19)20)2-4-12(11)16(21,22)23/h2-7H,1H3 |
| InChIKey | PRRCJZVSHWUJFH-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|