About bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate
bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate (PubChem CID 118592938) has the molecular formula C16H6Cl2F6O4
and a molecular weight of 447.11 g/mol. Its IUPAC name is bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate.
Molecular Properties
| Compound Name | bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate |
| PubChem CID | 118592938 |
| Molecular Formula | C16H6Cl2F6O4 |
| Molecular Weight | 447.11 g/mol |
| Exact Mass | 445.95 |
| IUPAC Name | bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate |
| SMILES | O=C(Oc1ccc(Cl)cc1C(F)(F)F)C(=O)Oc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H6Cl2F6O4/c17-7-1-3-11(9(5-7)15(19,20)21)27-13(25)14(26)28-12-4-2-8(18)6-10(12)16(22,23)24/h1-6H |
| InChIKey | KGFZGBPLQZGBRF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.11 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate?
The IUPAC name of bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate (CID 118592938) is bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate.
What is the SMILES notation for bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate?
The canonical SMILES for bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate is O=C(Oc1ccc(Cl)cc1C(F)(F)F)C(=O)Oc1ccc(Cl)cc1C(F)(F)F.
What is the InChIKey of bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate?
The InChIKey is KGFZGBPLQZGBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H6Cl2F6O4/c17-7-1-3-11(9(5-7)15(19,20)21)27-13(25)14(26)28-12-4-2-8(18)6-10(12)16(22,23)24/h1-6H.
What are the key properties of bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate?
bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate has a molecular weight of 447.11 g/mol, XLogP of 5.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-chloro-2-(trifluoromethyl)phenyl] oxalate is sourced from PubChem (CID 118592938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).