C14H8ClF4NO2 — CID 3642626
(2-fluorophenyl) N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate (PubChem CID 3642626) has the molecular formula C14H8ClF4NO2 and a molecular weight of 333.67 g/mol. Its IUPAC name is (2-fluorophenyl) N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | (2-fluorophenyl) N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 3642626 |
| Molecular Formula | C14H8ClF4NO2 |
| Molecular Weight | 333.67 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | (2-fluorophenyl) N-[4-chloro-2-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)Oc1ccccc1F |
| InChI | InChI=1S/C14H8ClF4NO2/c15-8-5-6-11(9(7-8)14(17,18)19)20-13(21)22-12-4-2-1-3-10(12)16/h1-7H,(H,20,21) |
| InChIKey | HZWPRODXRDKQLO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.67 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |