C17H13ClF4N2O2 — CID 113001024
N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 113001024) has the molecular formula C17H13ClF4N2O2 and a molecular weight of 388.75 g/mol. Its IUPAC name is N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113001024 |
| Molecular Formula | C17H13ClF4N2O2 |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1F)NCC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13ClF4N2O2/c18-11-5-6-14(12(8-11)17(20,21)22)24-16(26)9-23-15(25)7-10-3-1-2-4-13(10)19/h1-6,8H,7,9H2,(H,23,25)(H,24,26) |
| InChIKey | VGANLRDQQBOHJH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |