C19H14ClF3N2O — CID 2518054
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 2518054) has the molecular formula C19H14ClF3N2O and a molecular weight of 378.78 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 2518054 |
| Molecular Formula | C19H14ClF3N2O |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | O=C(CNc1ccc2ccccc2c1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C19H14ClF3N2O/c20-14-6-8-17(16(10-14)19(21,22)23)25-18(26)11-24-15-7-5-12-3-1-2-4-13(12)9-15/h1-10,24H,11H2,(H,25,26) |
| InChIKey | XGWGFHPCBPMAJR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |