C15H12ClF3N2O2S — CID 113001015
N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-thiophen-2-ylacetamide (PubChem CID 113001015) has the molecular formula C15H12ClF3N2O2S and a molecular weight of 376.79 g/mol. Its IUPAC name is N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113001015 |
| Molecular Formula | C15H12ClF3N2O2S |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | N-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NCC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H12ClF3N2O2S/c16-9-3-4-12(11(6-9)15(17,18)19)21-14(23)8-20-13(22)7-10-2-1-5-24-10/h1-6H,7-8H2,(H,20,22)(H,21,23) |
| InChIKey | GTQOTWIOZJNBOH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |