About (4-chloro-2-methylphenyl) 4-phenylbenzoate
(4-chloro-2-methylphenyl) 4-phenylbenzoate (PubChem CID 4850627) has the molecular formula C20H15ClO2
and a molecular weight of 322.79 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 4-phenylbenzoate.
Molecular Properties
| Compound Name | (4-chloro-2-methylphenyl) 4-phenylbenzoate |
| PubChem CID | 4850627 |
| Molecular Formula | C20H15ClO2 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (4-chloro-2-methylphenyl) 4-phenylbenzoate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15ClO2/c1-14-13-18(21)11-12-19(14)23-20(22)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-13H,1H3 |
| InChIKey | ZVRQKDHTSOPNJU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2-methylphenyl) 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2-methylphenyl) 4-phenylbenzoate?
The IUPAC name of (4-chloro-2-methylphenyl) 4-phenylbenzoate (CID 4850627) is (4-chloro-2-methylphenyl) 4-phenylbenzoate.
What is the SMILES notation for (4-chloro-2-methylphenyl) 4-phenylbenzoate?
The canonical SMILES for (4-chloro-2-methylphenyl) 4-phenylbenzoate is Cc1cc(Cl)ccc1OC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (4-chloro-2-methylphenyl) 4-phenylbenzoate?
The InChIKey is ZVRQKDHTSOPNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClO2/c1-14-13-18(21)11-12-19(14)23-20(22)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-13H,1H3.
What are the key properties of (4-chloro-2-methylphenyl) 4-phenylbenzoate?
(4-chloro-2-methylphenyl) 4-phenylbenzoate has a molecular weight of 322.79 g/mol, XLogP of 5.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2-methylphenyl) 4-phenylbenzoate is sourced from PubChem (CID 4850627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).