C26H17Cl2NO3 — CID 5216862
(2,4-dichlorophenyl) 4-[(2-hydroxy-5-phenylphenyl)iminomethyl]benzoate (PubChem CID 5216862) has the molecular formula C26H17Cl2NO3 and a molecular weight of 462.33 g/mol. Its IUPAC name is (2,4-dichlorophenyl) 4-[(2-hydroxy-5-phenylphenyl)iminomethyl]benzoate.
| Compound Name | (2,4-dichlorophenyl) 4-[(2-hydroxy-5-phenylphenyl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 5216862 |
| Molecular Formula | C26H17Cl2NO3 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (2,4-dichlorophenyl) 4-[(2-hydroxy-5-phenylphenyl)iminomethyl]benzoate |
| SMILES | O=C(Oc1ccc(Cl)cc1Cl)c1ccc(/C=N/c2cc(-c3ccccc3)ccc2O)cc1 |
| InChI | InChI=1S/C26H17Cl2NO3/c27-21-11-13-25(22(28)15-21)32-26(31)19-8-6-17(7-9-19)16-29-23-14-20(10-12-24(23)30)18-4-2-1-3-5-18/h1-16,30H/b29-16+ |
| InChIKey | LFBRDPNYLICQEF-MUFRIFMGSA-N |
| XLogP | 7.34 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|