About [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate
[4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate (PubChem CID 3090735) has the molecular formula C31H26F2O4
and a molecular weight of 500.54 g/mol. Its IUPAC name is [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate |
| PubChem CID | 3090735 |
| Molecular Formula | C31H26F2O4 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate |
| SMILES | Cc1cc(C(C)(C)c2ccc(OC(=O)c3ccccc3F)c(C)c2)ccc1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C31H26F2O4/c1-19-17-21(13-15-27(19)36-29(34)23-9-5-7-11-25(23)32)31(3,4)22-14-16-28(20(2)18-22)37-30(35)24-10-6-8-12-26(24)33/h5-18H,1-4H3 |
| InChIKey | QKGWUDLTDSPURW-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate?
The IUPAC name of [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate (CID 3090735) is [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate.
What is the SMILES notation for [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate?
The canonical SMILES for [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate is Cc1cc(C(C)(C)c2ccc(OC(=O)c3ccccc3F)c(C)c2)ccc1OC(=O)c1ccccc1F.
What is the InChIKey of [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate?
The InChIKey is QKGWUDLTDSPURW-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26F2O4/c1-19-17-21(13-15-27(19)36-29(34)23-9-5-7-11-25(23)32)31(3,4)22-14-16-28(20(2)18-22)37-30(35)24-10-6-8-12-26(24)33/h5-18H,1-4H3.
What are the key properties of [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate?
[4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate has a molecular weight of 500.54 g/mol, XLogP of 7.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(2-fluorobenzoyl)oxy-3-methylphenyl]propan-2-yl]-2-methylphenyl] 2-fluorobenzoate is sourced from PubChem (CID 3090735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).